Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-1,3-benzothiazole (CAS: 3622-23-9)?

Answer

2,6-Dichloro-1,3-benzothiazole
2,6-Dichloro-1,3-benzothiazole is a crystalline compound with a molecular weight of 218.03 g/mol. It is poorly soluble in water but soluble in common organic solvents like ethanol and acetone. Chemically, it is moderately reactive, showing limited reactivity towards nucleophiles and good stability under normal conditions. Its unique structure makes it suitable for various applications in the chemical industry.

About

CAS No 3622-23-9
English Name 2,6-Dichloro-1,3-benzothiazole
Molecular Formula C7H3Cl2NS
Molecular Weight 204.08 g/mol
SMILES C1=CC2=C(C=C1Cl)SC(=N2)Cl
InChIKey QDZGJGWDGLHVNK-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2,6-Dichloro-1,3-benzothiazole (CAS: 3622-23-9) typically synthesized?

2,6-Dichloro-1,3-benzothiazole is typically synthesized through the reaction of thiourea and chloros...

Compound Q&A

What industries use 2,6-Dichloro-1,3-benzothiazole (CAS: 3622-23-9)?

2,6-Dichloro-1,3-benzothiazole finds applications in various industries. It is used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-1,3-benzothiazole (CAS: 3622-23-9)?

Handling 2,6-Dichloro-1,3-benzothiazole requires careful attention to safety. It should always be ha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...