Compound Q&A

What precautions should be taken when handling (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (CAS: 55812-90-3)?

Answer

(11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (1:1)
Handling this compound requires the use of personal protective equipment (PPE) such as gloves and safety goggles. It should be conducted in a well-ventilated area or a fume hood to prevent inhalation. Spills should be managed carefully, and the material safety data sheet (MSDS) should be consulted for specific spill procedures. The compound is stable under normal conditions but should be stored away from moisture and light.

About

CAS No 55812-90-3
English Name (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (1:1)
Molecular Formula C24H33FO7
Molecular Weight 452.52 g/mol
SMILES CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COC(=O)C)O)C)O)F)C.O
InChIKey DPHFJXVKASDMBW-RQRKFSSASA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (CAS: 55812-90-3)?

This compound is a hydrate and crystalline in form. It has a molecular weight of approximately 517.6...

Compound Q&A

How is (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (CAS: 55812-90-3) typically synthesized?

This compound is typically synthesized via a multi-step process involving the reduction of a fluoro-...

Compound Q&A

What industries use (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (CAS: 55812-90-3)?

This compound is primarily used in the pharmaceutical industry due to its hormonal properties. It is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...