Compound Q&A

How is (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (CAS: 55812-90-3) typically synthesized?

Answer

(11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (1:1)
This compound is typically synthesized via a multi-step process involving the reduction of a fluoro-pregnanone, followed by acetylation and hydration. The synthesis involves the use of a palladium catalyst for the reduction step, ensuring high selectivity and yield. The final step involves the addition of acetic acid and water to form the hydrate.

About

CAS No 55812-90-3
English Name (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (1:1)
Molecular Formula C24H33FO7
Molecular Weight 452.52 g/mol
SMILES CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COC(=O)C)O)C)O)F)C.O
InChIKey DPHFJXVKASDMBW-RQRKFSSASA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (CAS: 55812-90-3)?

This compound is a hydrate and crystalline in form. It has a molecular weight of approximately 517.6...

Compound Q&A

What industries use (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (CAS: 55812-90-3)?

This compound is primarily used in the pharmaceutical industry due to its hormonal properties. It is...

Compound Q&A

What precautions should be taken when handling (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate hydrate (CAS: 55812-90-3)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves and sa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...