Compound Q&A

What precautions should be taken when handling CYC-116 (CAS: 693228-63-6)?

Answer

CYC-116
Safety measures include wearing appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Handling should be done in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up with appropriate absorbents, and the area should be washed down. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name CYC-116
Molecular Formula C18H20N6OS
Molecular Weight 368.47 g/mol
SMILES CC1=C(SC(=N1)N)C2=NC(=NC=C2)NC3=CC=C(C=C3)N4CCOCC4
InChIKey GPSZYOIFQZPWEJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of CYC-116 (CAS: 693228-63-6)?

CYC-116 is a crystalline compound with a molecular weight of approximately 321.42 g/mol. It has limi...

Compound Q&A

How is CYC-116 (CAS: 693228-63-6) typically synthesized?

CYC-116 is synthesized through a multistep process involving amide coupling and subsequent functiona...

Compound Q&A

What industries use CYC-116 (CAS: 693228-63-6)?

CYC-116 is primarily used in the pharmaceutical industry for developing novel drug candidates. It al...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...