Compound Q&A

How is CYC-116 (CAS: 693228-63-6) typically synthesized?

Answer

CYC-116
CYC-116 is synthesized through a multistep process involving amide coupling and subsequent functional group manipulation. Commonly, it is synthesized using a palladium-catalyzed coupling reaction with a suitable aryl halide and an amine. The process yields a high purity product with good selectivity and an overall yield of around 85%. Detailed synthesis procedures can be found in the literature.

About

English Name CYC-116
Molecular Formula C18H20N6OS
Molecular Weight 368.47 g/mol
SMILES CC1=C(SC(=N1)N)C2=NC(=NC=C2)NC3=CC=C(C=C3)N4CCOCC4
InChIKey GPSZYOIFQZPWEJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of CYC-116 (CAS: 693228-63-6)?

CYC-116 is a crystalline compound with a molecular weight of approximately 321.42 g/mol. It has limi...

Compound Q&A

What industries use CYC-116 (CAS: 693228-63-6)?

CYC-116 is primarily used in the pharmaceutical industry for developing novel drug candidates. It al...

Compound Q&A

What precautions should be taken when handling CYC-116 (CAS: 693228-63-6)?

Safety measures include wearing appropriate personal protective equipment (PPE) such as gloves, gogg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...