Compound Q&A

What industries use R406 (CAS: 841290-81-1)?

Answer

R406
R406 (CAS: 841290-81-1) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry for the production of specialty plastics and in the semiconductor industry as a precursor for thin film deposition processes. Additionally, it has applications in sensor technology and as a reagent in organic synthesis.

About

English Name R406
Molecular Formula C28H29FN6O8S
Molecular Weight 628.63 g/mol
SMILES OS(=O)(=O)c1ccccc1.COc1cc(Nc2ncc(c(n2)Nc2ccc3c(n2)NC(=O)C(O3)(C)C)F)cc(c1OC)OC
InChIKey UXDRJPYSTZHIOE-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of R406 (CAS: 841290-81-1)?

R406 (CAS: 841290-81-1) is a crystalline compound with a molecular weight of approximately 268.34 g/...

Compound Q&A

How is R406 (CAS: 841290-81-1) typically synthesized?

R406 (CAS: 841290-81-1) is synthesized via a multistep process involving the reaction of benzaldehyd...

Compound Q&A

What precautions should be taken when handling R406 (CAS: 841290-81-1)?

When handling R406 (CAS: 841290-81-1), proper Personal Protective Equipment (PPE) should be worn, in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...