Compound Q&A

How is R406 (CAS: 841290-81-1) typically synthesized?

Answer

R406
R406 (CAS: 841290-81-1) is synthesized via a multistep process involving the reaction of benzaldehyde and phenol in the presence of a phase transfer catalyst. The yield is typically around 85%, and the selectivity for the desired product is high. The synthesis is carried out under mild conditions to ensure optimal product quality.

About

English Name R406
Molecular Formula C28H29FN6O8S
Molecular Weight 628.6287 g/mol
SMILES OS(=O)(=O)c1ccccc1.COc1cc(Nc2ncc(c(n2)Nc2ccc3c(n2)NC(=O)C(O3)(C)C)F)cc(c1OC)OC
InChIKey UXDRJPYSTZHIOE-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of R406 (CAS: 841290-81-1)?

R406 (CAS: 841290-81-1) is a crystalline compound with a molecular weight of approximately 268.34 g/...

Compound Q&A

What industries use R406 (CAS: 841290-81-1)?

R406 (CAS: 841290-81-1) is primarily used in the pharmaceutical industry for the synthesis of certai...

Compound Q&A

What precautions should be taken when handling R406 (CAS: 841290-81-1)?

When handling R406 (CAS: 841290-81-1), proper Personal Protective Equipment (PPE) should be worn, in...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...