Compound Q&A

What industries use methyl 2-((2-phenylethylidene)amino)benzoate (CAS: 68391-08-2)?

Answer

methyl 2-((2-phenylethylidene)amino)benzoate
Methyl 2-((2-phenylethylidene)amino)benzoate is used in the pharmaceutical industry as an intermediate for the synthesis of certain drugs. It is also applied in the polymer industry for its potential to enhance the properties of polymer materials. Additionally, it may be used in the sensor and semiconductor industries for specific chemical functionalization purposes, although its use in these areas is less common.

About

CAS No 68391-08-2
English Name methyl 2-((2-phenylethylidene)amino)benzoate
Molecular Formula C16H15NO2
Molecular Weight 253.3 g/mol
EINECS 269-927-8
SMILES COC(=O)c1ccccc1N=CCc1ccccc1
InChIKey UTUBQSIVMXUACR-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 2-((2-phenylethylidene)amino)benzoate (CAS: 68391-08-2)?

Methyl 2-((2-phenylethylidene)amino)benzoate is a white crystalline solid with a molecular weight of...

Compound Q&A

How is methyl 2-((2-phenylethylidene)amino)benzoate (CAS: 68391-08-2) typically synthesized?

Methyl 2-((2-phenylethylidene)amino)benzoate is synthesized via amidation of 2-phenylethenamine with...

Compound Q&A

What precautions should be taken when handling methyl 2-((2-phenylethylidene)amino)benzoate (CAS: 68391-08-2)?

When handling methyl 2-((2-phenylethylidene)amino)benzoate, it is essential to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...