Compound Q&A

How is methyl 2-((2-phenylethylidene)amino)benzoate (CAS: 68391-08-2) typically synthesized?

Answer

methyl 2-((2-phenylethylidene)amino)benzoate
Methyl 2-((2-phenylethylidene)amino)benzoate is synthesized via amidation of 2-phenylethenamine with methyl benzoate. The reaction is typically conducted in the presence of a catalytic amount of a base such as triethylamine. The process yields a mixture of regioisomers, with the desired product being the major component. The yield can be improved by optimizing reaction conditions, such as temperature and solvent choice.

About

CAS No 68391-08-2
English Name methyl 2-((2-phenylethylidene)amino)benzoate
Molecular Formula C16H15NO2
Molecular Weight 253.3 g/mol
EINECS 269-927-8
SMILES COC(=O)c1ccccc1N=CCc1ccccc1
InChIKey UTUBQSIVMXUACR-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 2-((2-phenylethylidene)amino)benzoate (CAS: 68391-08-2)?

Methyl 2-((2-phenylethylidene)amino)benzoate is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use methyl 2-((2-phenylethylidene)amino)benzoate (CAS: 68391-08-2)?

Methyl 2-((2-phenylethylidene)amino)benzoate is used in the pharmaceutical industry as an intermedia...

Compound Q&A

What precautions should be taken when handling methyl 2-((2-phenylethylidene)amino)benzoate (CAS: 68391-08-2)?

When handling methyl 2-((2-phenylethylidene)amino)benzoate, it is essential to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...