Compound Q&A

What industries use Ethyl N-(2,3-dichloro-6-aminobenzyl)glycine (CAS: 70406-92-7)?

Answer

Ethyl N-(2,3-dichloro-6-aminobenzyl)glcycine
Ethyl N-(2,3-dichloro-6-aminobenzyl)glycine finds application in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients. It is also used in the polymer industry for the development of special polymer additives and in the field of sensors for its reactivity towards certain analytes.

About

CAS No 70406-92-7
English Name Ethyl N-(2,3-dichloro-6-aminobenzyl)glcycine
Molecular Formula C11H14Cl2N2O2
Molecular Weight 277.14 g/mol
SMILES CCOC(=O)CNCC1=C(C=CC(=C1Cl)Cl)N
InChIKey GXKCDDOGWWCMAO-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl N-(2,3-dichloro-6-aminobenzyl)glycine (CAS: 70406-92-7)?

Ethyl N-(2,3-dichloro-6-aminobenzyl)glycine is a crystalline compound with a molecular weight of app...

Compound Q&A

How is Ethyl N-(2,3-dichloro-6-aminobenzyl)glycine (CAS: 70406-92-7) typically synthesized?

Ethyl N-(2,3-dichloro-6-aminobenzyl)glycine can be synthesized through a multi-step process involvin...

Compound Q&A

What precautions should be taken when handling Ethyl N-(2,3-dichloro-6-aminobenzyl)glycine (CAS: 70406-92-7)?

When handling Ethyl N-(2,3-dichloro-6-aminobenzyl)glycine, proper personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...