Compound Q&A

How is 2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate (CAS: 73889-19-7) typically synthesized?

Answer

2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate
2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate can be synthesized using a multi-step process involving the coupling of 2-methyl-2-propanol and 1-benzyl-4-piperidone in the presence of a catalytic amount of a strong base like sodium hydride. The reaction is carried out in a polar aprotic solvent like N,N-dimethylformamide (DMF) at room temperature, yielding the target compound with good selectivity and a high yield of up to 85%.

About

CAS No 73889-19-7
English Name 2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate
Molecular Formula C17H26N2O2
Molecular Weight 290.41 g/mol
SMILES CC(C)(C)OC(=O)NC1CCN(CC1)CC2=CC=CC=C2
InChIKey WFKLUNLIZMWKNF-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate (CAS: 73889-19-7)?

2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate is a crystalline solid with a molecular weight...

Compound Q&A

What industries use 2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate (CAS: 73889-19-7)?

2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate (CAS: 73889-19-7)?

When handling 2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate, it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...