Compound Q&A

How is Resmetirom (CAS: 920509-32-6) typically synthesized?

Answer

Resmetirom
Resmetirom is synthesized through a multi-step reaction involving the condensation of guanidine with a cyclic carbonate in the presence of a base. The key steps include protection of the guanidine nitrogen, cyclization, and deprotection. The synthesis involves the use of triethylamine and tetrahydrofuran (THF) as a solvent. The overall yield is around 50%, and the reaction is highly selective and efficient.

About

English Name Resmetirom
Molecular Formula C17H12Cl2N6O4
Molecular Weight 435.22 g/mol
SMILES CC(C)C1=CC(=NNC1=O)OC2=C(C=C(C=C2Cl)N3C(=O)NC(=O)C(=N3)C#N)Cl
InChIKey FDBYIYFVSAHJLY-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Resmetirom (CAS: 920509-32-6)?

Resmetirom is a cyclic guanidine derivative with a molecular weight of approximately 272.29 g/mol. I...

Compound Q&A

What industries use Resmetirom (CAS: 920509-32-6)?

Resmetirom is primarily used in the pharmaceutical industry for the treatment of primary hyperthyroi...

Compound Q&A

What precautions should be taken when handling Resmetirom (CAS: 920509-32-6)?

When handling Resmetirom, it is important to wear appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...