Compound Q&A

What are the physical and chemical properties of Resmetirom (CAS: 920509-32-6)?

Answer

Resmetirom
Resmetirom is a cyclic guanidine derivative with a molecular weight of approximately 272.29 g/mol. It is a white, crystalline solid with a melting point around 250°C. Resmetirom is slightly soluble in water and organic solvents such as ethanol and acetonitrile. It exhibits moderate reactivity towards strong acids and bases and is stable under normal conditions, but should be stored away from strong oxidizing agents.

About

English Name Resmetirom
Molecular Formula C17H12Cl2N6O4
Molecular Weight 435.22 g/mol
SMILES CC(C)C1=CC(=NNC1=O)OC2=C(C=C(C=C2Cl)N3C(=O)NC(=O)C(=N3)C#N)Cl
InChIKey FDBYIYFVSAHJLY-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Resmetirom (CAS: 920509-32-6) typically synthesized?

Resmetirom is synthesized through a multi-step reaction involving the condensation of guanidine with...

Compound Q&A

What industries use Resmetirom (CAS: 920509-32-6)?

Resmetirom is primarily used in the pharmaceutical industry for the treatment of primary hyperthyroi...

Compound Q&A

What precautions should be taken when handling Resmetirom (CAS: 920509-32-6)?

When handling Resmetirom, it is important to wear appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...