Compound Q&A

What industries use Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0)?

Answer

Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate
Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0) is primarily used in the pharmaceutical and chemical industries. It serves as a precursor in the synthesis of various bioactive compounds and drugs. Additionally, it finds applications in the polymer and sensor industries for its structural and functional properties.

About

CAS No 4739-94-0
English Name Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES CCOC(=O)C1COC2=CC=CC=C2O1
InChIKey DDIGEMWIKJMEIU-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0)?

Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0) is a white crystalline solid with ...

Compound Q&A

How is Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0) typically synthesized?

Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0) is typically synthesized through t...

Compound Q&A

What precautions should be taken when handling Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0)?

When handling Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...