Compound Q&A

What are the physical and chemical properties of Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0)?

Answer

Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate
Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0) is a white crystalline solid with a molecular weight of approximately 202.23 g/mol. It has a moderate solubility in common organic solvents such as ethanol and acetone. This compound is known for its reactivity in esterification and nucleophilic substitution reactions. It is often used in the synthesis of various bioactive compounds and pharmaceuticals.

About

CAS No 4739-94-0
English Name Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES CCOC(=O)C1COC2=CC=CC=C2O1
InChIKey DDIGEMWIKJMEIU-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0) typically synthesized?

Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0) is typically synthesized through t...

Compound Q&A

What industries use Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0)?

Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0) is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0)?

When handling Ethyl 2,3-dihydro-1,4-benzodioxine-2-carboxylate (CAS: 4739-94-0), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...