Compound Q&A

How is Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9) typically synthesized?

Answer

Palladium(II) hexafluoroacetylacetonate
Palladium(II) hexafluoroacetylacetonate is typically synthesized by reacting palladium(II) salts with hexafluoroacetylacetonate in an inert solvent. The reaction is usually carried out in the presence of a base to ensure optimal yield and selectivity. This compound is often used as a catalyst in palladium-catalyzed reactions.

About

CAS No 64916-48-9
English Name Palladium(II) hexafluoroacetylacetonate
Molecular Formula C10H2F12O4Pd
Molecular Weight 520.52 g/mol
SMILES O=C(C(F)(F)F)[CH-]C(=O)C(F)(F)F.O=C(C(F)(F)F)[CH-]C(=O)C(F)(F)F.[Pd+2]
InChIKey OVIDFVVPPRGPGR-PAMPIZDHSA-L
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9)?

Palladium(II) hexafluoroacetylacetonate is a pale yellow solid with a molecular weight of approximat...

Compound Q&A

What industries use Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9)?

Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9)?

When handling Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9), it is important to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...