Compound Q&A

What are the physical and chemical properties of Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9)?

Answer

Palladium(II) hexafluoroacetylacetonate
Palladium(II) hexafluoroacetylacetonate is a pale yellow solid with a molecular weight of approximately 398.04 g/mol. It has low solubility in water but is soluble in most organic solvents. The compound is known for its high reactivity and stability in air, making it suitable for various catalytic applications.

About

CAS No 64916-48-9
English Name Palladium(II) hexafluoroacetylacetonate
Molecular Formula C10H2F12O4Pd
Molecular Weight 520.52 g/mol
SMILES O=C(C(F)(F)F)[CH-]C(=O)C(F)(F)F.O=C(C(F)(F)F)[CH-]C(=O)C(F)(F)F.[Pd+2]
InChIKey OVIDFVVPPRGPGR-PAMPIZDHSA-L
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9) typically synthesized?

Palladium(II) hexafluoroacetylacetonate is typically synthesized by reacting palladium(II) salts wit...

Compound Q&A

What industries use Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9)?

Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9)?

When handling Palladium(II) hexafluoroacetylacetonate (CAS: 64916-48-9), it is important to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...