Compound Q&A

What precautions should be taken when handling (2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CAS: 872365-14-5)?

Answer

{2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}acetic acid
When handling the compound, it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Handling should be done in a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbents, and the area should be ventilated. Always refer to the safety data sheet (SDS) for detailed handling and storage instructions.

About

English Name {2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}acetic acid
Molecular Formula C19H17F3N2O4S
Molecular Weight 426.42 g/mol
SMILES OC(=O)Cc1c(C)n(c2c1cccn2)Cc1ccc(cc1C(F)(F)F)S(=O)(=O)C
InChIKey GFPPXZDRVCSVNR-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CAS: 872365-14-5)?

The compound has a crystalline form and a molecular weight of approximately 539.68 g/mol. It is slig...

Compound Q&A

How is (2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CAS: 872365-14-5) typically synthesized?

The compound is typically synthesized through a multi-step process involving coupling reactions, alk...

Compound Q&A

What industries use (2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CAS: 872365-14-5)?

This compound is used in the pharmaceutical industry for drug development, particularly in the synth...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...