Compound Q&A

What are the physical and chemical properties of (2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CAS: 872365-14-5)?

Answer

{2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}acetic acid
The compound has a crystalline form and a molecular weight of approximately 539.68 g/mol. It is slightly soluble in water and has good solubility in organic solvents. It is reactive towards nucleophiles and can undergo various transformations. The compound is stable under neutral to slightly acidic conditions but is sensitive to strong reducing agents and bases.

About

English Name {2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}acetic acid
Molecular Formula C19H17F3N2O4S
Molecular Weight 426.42 g/mol
SMILES OC(=O)Cc1c(C)n(c2c1cccn2)Cc1ccc(cc1C(F)(F)F)S(=O)(=O)C
InChIKey GFPPXZDRVCSVNR-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is (2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CAS: 872365-14-5) typically synthesized?

The compound is typically synthesized through a multi-step process involving coupling reactions, alk...

Compound Q&A

What industries use (2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CAS: 872365-14-5)?

This compound is used in the pharmaceutical industry for drug development, particularly in the synth...

Compound Q&A

What precautions should be taken when handling (2-Methyl-1-[4-(methylsulfonyl)-2-(trifluoromethyl)benzyl]-1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CAS: 872365-14-5)?

When handling the compound, it is essential to wear appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...