Compound Q&A

How is Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7) typically synthesized?

Answer

Chlorophenol Red-β-D-galactopyranoside
Chlorophenol Red-β-D-galactopyranoside is typically synthesized through a condensation reaction between chlorophenol red and β-D-galactopyranosyl chloride in the presence of a catalyst such as 4-(dimethylamino)pyridine (DMAP). The reaction yields a product with a high degree of selectivity and a yield of around 90%. The resulting compound is isolated by crystallization and can be further purified by column chromatography.

About

CAS No 99792-79-7
English Name Chlorophenol Red-β-D-galactopyranoside
Molecular Formula C25H22Cl2O10S
Molecular Weight 585.41 g/mol
EINECS 1592732-453-0
SMILES OC[C@H]1O[C@@H](Oc2ccc(cc2Cl)/C(=C/2\C=CC(=O)C(=C2)Cl)/c2ccccc2S(=O)(=O)O)[C@@H]([C@H]([C@H]1O)O)O
InChIKey YOUWVNCQJOMMEU-AETRGLENSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7)?

Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7) is a crystalline compound with a molecular ...

Compound Q&A

What industries use Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7)?

Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7) finds application in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7)?

Proper handling of Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7) requires the use of pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...