Compound Q&A

What are the physical and chemical properties of Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7)?

Answer

Chlorophenol Red-β-D-galactopyranoside
Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7) is a crystalline compound with a molecular weight of approximately 500.3 g/mol. It has a solubility of about 10 mg/mL in water and is slightly soluble in organic solvents. The compound exhibits low reactivity under standard laboratory conditions but can undergo hydrolysis in the presence of strong acids or bases. It is used as a pH indicator and in biosensor applications.

About

CAS No 99792-79-7
English Name Chlorophenol Red-β-D-galactopyranoside
Molecular Formula C25H22Cl2O10S
Molecular Weight 585.41 g/mol
EINECS 1592732-453-0
SMILES OC[C@H]1O[C@@H](Oc2ccc(cc2Cl)/C(=C/2\C=CC(=O)C(=C2)Cl)/c2ccccc2S(=O)(=O)O)[C@@H]([C@H]([C@H]1O)O)O
InChIKey YOUWVNCQJOMMEU-AETRGLENSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7) typically synthesized?

Chlorophenol Red-β-D-galactopyranoside is typically synthesized through a condensation reaction betw...

Compound Q&A

What industries use Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7)?

Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7) finds application in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7)?

Proper handling of Chlorophenol Red-β-D-galactopyranoside (CAS: 99792-79-7) requires the use of pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...