Compound Q&A

Is (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol (CAS: 490-23-3) safe?

Answer

(2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol
The safety of this compound is generally considered acceptable for its intended uses. However, users should follow all safety guidelines and use protective measures when handling the compound to minimize any potential risks. Detailed safety data and protocols are recommended for specific applications.

About

CAS No 490-23-3
English Name (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol
Molecular Formula C28H42O2
Molecular Weight 410.64 g/mol
SMILES CC1=CC(=C(C2=C1OC(CC2)(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C)O
InChIKey FGYKUFVNYVMTAM-WAZJVIJMSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol (CAS: 490-23-3)?

This compound is a specific chromanol derivative with a unique molecular structure. It is characteri...

Compound Q&A

What are the main uses of (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol (CAS: 490-23-3)?

This compound is primarily used in the pharmaceutical industry for its potential applications in med...

Compound Q&A

How should (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol (CAS: 490-23-3) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...