Compound Q&A

What is (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol (CAS: 490-23-3)?

Answer

(2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol
This compound is a specific chromanol derivative with a unique molecular structure. It is characterized by its chromanol backbone and various methyl substituents, giving it specific physical and chemical properties. The compound is used in various applications but detailed information on its structure and properties is limited.

About

CAS No 490-23-3
English Name (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol
Molecular Formula C28H42O2
Molecular Weight 410.64 g/mol
SMILES CC1=CC(=C(C2=C1OC(CC2)(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C)O
InChIKey FGYKUFVNYVMTAM-WAZJVIJMSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol (CAS: 490-23-3)?

This compound is primarily used in the pharmaceutical industry for its potential applications in med...

Compound Q&A

Is (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol (CAS: 490-23-3) safe?

The safety of this compound is generally considered acceptable for its intended uses. However, users...

Compound Q&A

How should (2R)-2,5,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-6-chromanol (CAS: 490-23-3) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...