Compound Q&A

How should Ethyl 5-fluoro-1H-indole-2-carboxylate (CAS: 348-36-7) be stored?

Answer

Ethyl 5-fluoro-1H-indole-2-carboxylate
Ethyl 5-fluoro-1H-indole-2-carboxylate (CAS: 348-36-7) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation. Proper storage conditions are essential to maintain its chemical integrity and ensure safe handling during use.

About

CAS No 348-36-7
English Name Ethyl 5-fluoro-1H-indole-2-carboxylate
Molecular Formula C11H10FNO2
Molecular Weight 207.2 g/mol
SMILES CCOC(=O)C1=CC2=C(N1)C=CC(=C2)F
InChIKey VIKOQTQMWBKMNA-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is Ethyl 5-fluoro-1H-indole-2-carboxylate (CAS: 348-36-7)?

Ethyl 5-fluoro-1H-indole-2-carboxylate (CAS: 348-36-7) is an organic compound with the molecular for...

Compound Q&A

What are the main uses of Ethyl 5-fluoro-1H-indole-2-carboxylate (CAS: 348-36-7)?

Ethyl 5-fluoro-1H-indole-2-carboxylate (CAS: 348-36-7) is primarily used in the synthesis of indole-...

Compound Q&A

Is Ethyl 5-fluoro-1H-indole-2-carboxylate (CAS: 348-36-7) safe?

Ethyl 5-fluoro-1H-indole-2-carboxylate (CAS: 348-36-7) is generally considered safe for laboratory u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...