Compound Q&A

How should 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) be stored?

Answer

2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate
2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent exposure to air and moisture. Ideal storage conditions are between 15°C and 25°C, with a relative humidity below 60% to maintain its stability and reactivity.

About

English Name 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate
Molecular Formula C16H23NO5
Molecular Weight 309.36 g/mol
SMILES COC(=O)Oc1cc([N+](=O)[O-])c(cc1C(C)(C)C)C(C)(C)C
InChIKey QBDLLAFFRJOLHZ-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1)?

2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) is a chemical compoun...

Compound Q&A

What are the main uses of 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1)?

2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) is primarily used in ...

Compound Q&A

Is 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) safe?

2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) is generally consider...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...