Compound Q&A

What are the main uses of 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1)?

Answer

2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate
2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) is primarily used in organic synthesis as a reagent. It finds applications in both academic and industrial research for its ability to participate in various chemical reactions, particularly those involving nitro groups and methyl esters. Its reactivity makes it useful in pharmaceutical and chemical manufacturing processes.

About

English Name 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate
Molecular Formula C16H23NO5
Molecular Weight 309.36 g/mol
SMILES COC(=O)Oc1cc([N+](=O)[O-])c(cc1C(C)(C)C)C(C)(C)C
InChIKey QBDLLAFFRJOLHZ-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1)?

2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) is a chemical compoun...

Compound Q&A

Is 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) safe?

2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) is generally consider...

Compound Q&A

How should 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) be stored?

2,4-Bis(2-methyl-2-propanyl)-5-nitrophenyl methyl carbonate (CAS: 873055-55-1) should be stored in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...