Compound Q&A

How should (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (CAS: 500791-70-8) be stored?

Answer

(5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (1:1)
This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly closed container to prevent degradation. It is advisable to store it at room temperature or slightly below to ensure its stability and effectiveness.

About

English Name (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (1:1)
Molecular Formula C32H44N2O7
Molecular Weight 568.71 g/mol
SMILES O=C(C1=C(CCCC)OC2=CC=C(N)C=C12)C3=CC=C(OCCCN(CCCC)CCCC)C=C3.O=C(O)C(O)=O
InChIKey VJVFIQVIPOMHOP-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (CAS: 500791-70-8)?

CAS 500791-70-8 is a complex organic compound with the structure (5-Amino-2-butyl-1-benzofuran-3-yl)...

Compound Q&A

What are the main uses of (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (CAS: 500791-70-8)?

This compound is primarily used in pharmaceuticals and research due to its unique chemical propertie...

Compound Q&A

Is (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (CAS: 500791-70-8) safe?

The compound is generally considered safe when handled with appropriate precautions. However, it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...