Compound Q&A

Is (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (CAS: 500791-70-8) safe?

Answer

(5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (1:1)
The compound is generally considered safe when handled with appropriate precautions. However, it is important to follow safety guidelines, including wearing protective clothing and ensuring proper ventilation. Exposure to high temperatures or direct sunlight should be avoided to prevent degradation.

About

English Name (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (1:1)
Molecular Formula C32H44N2O7
Molecular Weight 568.71 g/mol
SMILES O=C(C1=C(CCCC)OC2=CC=C(N)C=C12)C3=CC=C(OCCCN(CCCC)CCCC)C=C3.O=C(O)C(O)=O
InChIKey VJVFIQVIPOMHOP-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (CAS: 500791-70-8)?

CAS 500791-70-8 is a complex organic compound with the structure (5-Amino-2-butyl-1-benzofuran-3-yl)...

Compound Q&A

What are the main uses of (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (CAS: 500791-70-8)?

This compound is primarily used in pharmaceuticals and research due to its unique chemical propertie...

Compound Q&A

How should (5-Amino-2-butyl-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone ethanedioate (CAS: 500791-70-8) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...