Compound Q&A

How should waste containing ophiopogonin B (CAS: 38971-41-4) be handled?

Answer

ophiopogonin B
Waste containing ophiopogonin B (CAS: 38971-41-4) should be collected in sealed containers and disposed of through professional waste disposal services. Incineration is a common method, but environmental protection measures should be taken to minimize the release of harmful substances into the environment. Compliance with local hazardous waste regulations is essential.

About

CAS No 38971-41-4
English Name ophiopogonin B
Molecular Formula C39H62O12
Molecular Weight 722.9 g/mol
SMILES CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(C(CC(C6)O)OC7C(C(C(C(O7)C)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)C)OC1
InChIKey OWGURJWJHWYCIQ-AKYREZHBSA-N
Last Updated: 2025-10-15 11:13

Related Q&A

Compound Q&A

What regulatory guidelines apply to ophiopogonin B (CAS: 38971-41-4)?

Ophiopogonin B (CAS: 38971-41-4) should comply with global regulatory guidelines such as the Globall...

Compound Q&A

Are there alternatives to ophiopogonin B (CAS: 38971-41-4) in synthesis?

Synthesizers often explore alternatives to ophiopogonin B (CAS: 38971-41-4) such as related ophiopog...

Compound Q&A

What is the market or research trend for ophiopogonin B (CAS: 38971-41-4)?

Ophiopogonin B (CAS: 38971-41-4) is gaining attention in research for its potential medicinal proper...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...