Compound Q&A

What regulatory guidelines apply to ophiopogonin B (CAS: 38971-41-4)?

Answer

ophiopogonin B
Ophiopogonin B (CAS: 38971-41-4) should comply with global regulatory guidelines such as the Globally Harmonized System of Classification and Labelling of Chemicals (GHS), REACH regulations in the European Union, and FDA/EPA guidelines in the United States. These guidelines cover hazard communication, workplace safety, and environmental protection.

About

CAS No 38971-41-4
English Name ophiopogonin B
Molecular Formula C39H62O12
Molecular Weight 722.9 g/mol
SMILES CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(C(CC(C6)O)OC7C(C(C(C(O7)C)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)C)OC1
InChIKey OWGURJWJHWYCIQ-AKYREZHBSA-N
Last Updated: 2025-10-15 11:13

Related Q&A

Compound Q&A

Are there alternatives to ophiopogonin B (CAS: 38971-41-4) in synthesis?

Synthesizers often explore alternatives to ophiopogonin B (CAS: 38971-41-4) such as related ophiopog...

Compound Q&A

What is the market or research trend for ophiopogonin B (CAS: 38971-41-4)?

Ophiopogonin B (CAS: 38971-41-4) is gaining attention in research for its potential medicinal proper...

Compound Q&A

How should waste containing ophiopogonin B (CAS: 38971-41-4) be handled?

Waste containing ophiopogonin B (CAS: 38971-41-4) should be collected in sealed containers and dispo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...