Compound Q&A

How should waste containing 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid be handled?

Answer

2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid
Waste containing 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid (CAS: 1103234-56-5) should be managed in accordance with local and international waste disposal regulations. Collect waste liquids in appropriate containers and ensure proper ventilation during handling. Incineration is a common disposal method, but professional waste disposal services are recommended for larger quantities or hazardous waste. Implement safety precautions such as wearing protective gear and following proper procedures to prevent environmental contamination and ensure worker safety.

About

English Name 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid
Molecular Formula C10H11F2NO4S
Molecular Weight 279.26 g/mol
SMILES CCCS(=O)(=O)Nc1ccc(c(c1F)C(=O)O)F
InChIKey RTAWCKGXCGSFJI-UHFFFAOYSA-N
Last Updated: 2025-10-15 11:13

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid (CAS: 1103234-56-5)?

2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid (CAS: 1103234-56-5) is subject to various regulat...

Compound Q&A

Are there alternatives to 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid in synthesis?

Alternatives to 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid in synthesis include related comp...

Compound Q&A

What is the market or research trend for 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid?

The market for 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid (CAS: 1103234-56-5) is primarily d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...