Compound Q&A

Are there alternatives to 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid in synthesis?

Answer

2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid
Alternatives to 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid in synthesis include related compounds such as 2,6-difluorobenzoic acid or 3-(propylsulfonylamino)benzoic acid. These alternatives can be used as precursors or as the final product in different chemical processes. Common reagents for synthesis include propylsulfonyl chloride and appropriate amines. It's important to evaluate the availability, cost, and reactivity of these alternatives to find the most suitable one for your specific application.

About

English Name 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid
Molecular Formula C10H11F2NO4S
Molecular Weight 279.26 g/mol
SMILES CCCS(=O)(=O)Nc1ccc(c(c1F)C(=O)O)F
InChIKey RTAWCKGXCGSFJI-UHFFFAOYSA-N
Last Updated: 2025-10-15 11:13

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid (CAS: 1103234-56-5)?

2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid (CAS: 1103234-56-5) is subject to various regulat...

Compound Q&A

What is the market or research trend for 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid?

The market for 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid (CAS: 1103234-56-5) is primarily d...

Compound Q&A

How should waste containing 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid be handled?

Waste containing 2,6-Difluoro-3-[(propylsulfonyl)amino]benzoic acid (CAS: 1103234-56-5) should be ma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...