Compound Q&A

What industries use Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 122860-33-7)?

Answer

Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate
Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate finds applications in the pharmaceutical industry for the synthesis of various drugs. It is also used in the polymer industry as a monomer for the development of new polymers. Additionally, it has potential uses in the sensor and semiconductor industries due to its chemical properties.

About

English Name Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate
Molecular Formula C14H19NO3
Molecular Weight 249.31 g/mol
SMILES C1CN(CCC1CO)C(=O)OCC2=CC=CC=C2
InChIKey LINIORCIRVAZSM-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 122860-33-7)?

Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate is a solid with a crystalline form. Its molecular w...

Compound Q&A

How is Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 122860-33-7) typically synthesized?

Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate is typically synthesized via the reaction of benzyl...

Compound Q&A

What precautions should be taken when handling Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 122860-33-7)?

When handling Benzyl 4-(hydroxymethyl)-1-piperidinecarboxylate, proper personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...