Compound Q&A

What precautions should be taken when handling Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2)?

Answer

Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate)
When handling Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be used in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate materials, and the safety data sheet (SDS) should be consulted for detailed emergency procedures. Proper disposal should be in accordance with local regulations.

About

CAS No 20324-87-2
English Name Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate)
Molecular Formula C21H14N2Na2O9S2
Molecular Weight 548.5 g/mol
SMILES C1=CC2=C(C=C(C=C2C=C1NC(=O)NC3=CC4=CC(=CC(=C4C=C3)O)S(=O)(=O)[O-])S(=O)(=O)[O-])O.[Na+].[Na+]
InChIKey MOUNHKKCIGVIDI-UHFFFAOYSA-L
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2)?

Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2) is a crystall...

Compound Q&A

How is Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2) typically synthesized?

Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2) is typically ...

Compound Q&A

What industries use Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2)?

Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2) finds applica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...