Compound Q&A

What industries use Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2)?

Answer

Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate)
Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2) finds application in various industries. It is commonly used in the pharmaceutical sector for the synthesis of certain organic compounds and as a ligand in coordination chemistry. Additionally, it is employed in the production of dyes and pigments, as well as in chemical sensing devices and as a component in semiconductor materials.

About

CAS No 20324-87-2
English Name Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate)
Molecular Formula C21H14N2Na2O9S2
Molecular Weight 548.5 g/mol
SMILES C1=CC2=C(C=C(C=C2C=C1NC(=O)NC3=CC4=CC(=CC(=C4C=C3)O)S(=O)(=O)[O-])S(=O)(=O)[O-])O.[Na+].[Na+]
InChIKey MOUNHKKCIGVIDI-UHFFFAOYSA-L
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2)?

Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2) is a crystall...

Compound Q&A

How is Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2) typically synthesized?

Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2) is typically ...

Compound Q&A

What precautions should be taken when handling Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2)?

When handling Disodium 7,7'-(carbonyldiimino)bis(4-hydroxy-2-naphthalenesulfonate) (CAS: 20324-87-2)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...