Compound Q&A

What are the physical and chemical properties of 3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide (CAS: 4630-95-9)?

Answer

3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide
3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide is a crystalline solid with a molecular weight of approximately 518.5 g/mol. It has a high solubility in organic solvents and moderate solubility in water. Chemically, it is relatively stable but can react with strong acids or bases. Specific physical properties include a melting point of around 85-87°C.

About

CAS No 4630-95-9
English Name 3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide
Molecular Formula C22H28BrN
Molecular Weight 386.4 g/mol
SMILES CC[N+]1(CCC(=C(C2=CC=CC=C2)C3=CC=CC=C3)C1C)CC.[Br-]
InChIKey UCGJZJXOPSNTGZ-UHFFFAOYSA-M
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is 3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide (CAS: 4630-95-9) typically synthesized?

3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide is synthesized through the brominati...

Compound Q&A

What industries use 3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide (CAS: 4630-95-9)?

3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide is used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide (CAS: 4630-95-9)?

When handling 3-(Diphenylmethylene)-1,1-diethyl-2-methylpyrrolidinium bromide, it is important to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...