Compound Q&A

How is 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7) typically synthesized?

Answer

1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene)
1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7) is typically synthesized through the condensation of 2-nitrobenzaldehyde with ethylene glycol. The synthesis involves the use of a strong base like sodium ethoxide as a catalyst. The process yields a high purity product with a good selectivity and yield, making it suitable for various industrial applications.

About

CAS No 16968-19-7
English Name 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene)
Molecular Formula C14H12N2O4
Molecular Weight 272.26 g/mol
SMILES C1=CC=C(C(=C1)CCC2=CC=CC=C2[N+](=O)[O-])[N+](=O)[O-]
InChIKey YBOZRPPSBVIHGJ-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7)?

1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7) is a crystalline solid with a molecular w...

Compound Q&A

What industries use 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7)?

1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7)?

When handling 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7), it is crucial to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...