Compound Q&A

What are the physical and chemical properties of 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7)?

Answer

1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene)
1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7) is a crystalline solid with a molecular weight of approximately 262.14 g/mol. It is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound is known for its high reactivity, particularly towards nucleophilic substitution and reduction reactions.

About

CAS No 16968-19-7
English Name 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene)
Molecular Formula C14H12N2O4
Molecular Weight 272.26 g/mol
SMILES C1=CC=C(C(=C1)CCC2=CC=CC=C2[N+](=O)[O-])[N+](=O)[O-]
InChIKey YBOZRPPSBVIHGJ-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7) typically synthesized?

1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7) is typically synthesized through the cond...

Compound Q&A

What industries use 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7)?

1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7)?

When handling 1,1'-(1,2-Ethanediyl)bis(2-nitrobenzene) (CAS: 16968-19-7), it is crucial to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...