Compound Q&A

What precautions should be taken when handling 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate (CAS: 19321-40-5)?

Answer

3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate
When handling this compound, wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Ensure the use of a fume hood during handling and synthesis to minimize exposure. Store the compound in a cool, dry place away from direct sunlight and heat sources. In case of a spill, immediately contain it and clean up using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed emergency procedures and safety information.

About

CAS No 19321-40-5
English Name 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate
Molecular Formula C77H140O8
Molecular Weight 1193.96 g/mol
SMILES CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)(COC(=O)CCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCCC/C=C\CCCCCCCC
InChIKey QTIMEBJTEBWHOB-PMDAXIHYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate (CAS: 19321-40-5)?

The compound has a crystalline form with a molecular weight of approximately 628.94 g/mol. It is poo...

Compound Q&A

How is 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate (CAS: 19321-40-5) typically synthesized?

This compound is typically synthesized via esterification reactions involving 9-octadecenoic acid an...

Compound Q&A

What industries use 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate (CAS: 19321-40-5)?

This compound is used in the pharmaceutical industry for the synthesis of certain bioactive molecule...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...