Compound Q&A

What industries use 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate (CAS: 19321-40-5)?

Answer

3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate
This compound is used in the pharmaceutical industry for the synthesis of certain bioactive molecules due to its unique structural features. It is also utilized in the polymer industry for enhancing the performance of certain polymers. Additionally, it has potential applications in the sensor and semiconductor industries for its specific reactivity with organic molecules.

About

CAS No 19321-40-5
English Name 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate
Molecular Formula C77H140O8
Molecular Weight 1193.96 g/mol
SMILES CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)(COC(=O)CCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCCC/C=C\CCCCCCCC
InChIKey QTIMEBJTEBWHOB-PMDAXIHYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate (CAS: 19321-40-5)?

The compound has a crystalline form with a molecular weight of approximately 628.94 g/mol. It is poo...

Compound Q&A

How is 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate (CAS: 19321-40-5) typically synthesized?

This compound is typically synthesized via esterification reactions involving 9-octadecenoic acid an...

Compound Q&A

What precautions should be taken when handling 3-[(9Z)-9-Octadecenoyloxy]-2,2-bis{[(9Z)-9-octadecenoyloxy]methyl}propyl (9Z)-9-octadecenoate (CAS: 19321-40-5)?

When handling this compound, wear appropriate personal protective equipment (PPE) including gloves, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...