Compound Q&A

What industries use 3-(Methoxycarbonyl)benzoic acid (CAS: 1877-71-0)?

Answer

3-(Methoxycarbonyl)benzoic acid
3-(Methoxycarbonyl)benzoic acid is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly in the production of certain analgesics and antipyretics. It also finds applications in the manufacturing of polymers, sensors, and semiconductors due to its chemical properties.

About

CAS No 1877-71-0
English Name 3-(Methoxycarbonyl)benzoic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES COC(=O)C1=CC=CC(=C1)C(=O)O
InChIKey WMZNGTSLFSJHMZ-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Methoxycarbonyl)benzoic acid (CAS: 1877-71-0)?

3-(Methoxycarbonyl)benzoic acid is a solid with a crystalline form. Its molecular weight is approxim...

Compound Q&A

How is 3-(Methoxycarbonyl)benzoic acid (CAS: 1877-71-0) typically synthesized?

3-(Methoxycarbonyl)benzoic acid can be synthesized via the methylation of benzoic acid followed by a...

Compound Q&A

What precautions should be taken when handling 3-(Methoxycarbonyl)benzoic acid (CAS: 1877-71-0)?

When handling 3-(Methoxycarbonyl)benzoic acid, it is essential to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...