Compound Q&A

How is 3-(Methoxycarbonyl)benzoic acid (CAS: 1877-71-0) typically synthesized?

Answer

3-(Methoxycarbonyl)benzoic acid
3-(Methoxycarbonyl)benzoic acid can be synthesized via the methylation of benzoic acid followed by acylation with methoxycarbonyl chloride. Common catalysts include triethylamine, and the reaction generally yields a high purity product. The process is selective and efficient, with yields typically above 85%.

About

CAS No 1877-71-0
English Name 3-(Methoxycarbonyl)benzoic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES COC(=O)C1=CC=CC(=C1)C(=O)O
InChIKey WMZNGTSLFSJHMZ-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Methoxycarbonyl)benzoic acid (CAS: 1877-71-0)?

3-(Methoxycarbonyl)benzoic acid is a solid with a crystalline form. Its molecular weight is approxim...

Compound Q&A

What industries use 3-(Methoxycarbonyl)benzoic acid (CAS: 1877-71-0)?

3-(Methoxycarbonyl)benzoic acid is used in various industries. It is a key intermediate in the synth...

Compound Q&A

What precautions should be taken when handling 3-(Methoxycarbonyl)benzoic acid (CAS: 1877-71-0)?

When handling 3-(Methoxycarbonyl)benzoic acid, it is essential to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...