Compound Q&A

What precautions should be taken when handling trans-4-(2-Methyl-2-propanyl)cyclohexanol (CAS: 21862-63-5)?

Answer

trans-4-(2-Methyl-2-propanyl)cyclohexanol
When handling trans-4-(2-Methyl-2-propanyl)cyclohexanol, it is essential to use appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Handle the compound in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbents, and the area should be well-ventilated. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

CAS No 21862-63-5
English Name trans-4-(2-Methyl-2-propanyl)cyclohexanol
Molecular Formula C10H20O
Molecular Weight 156.27 g/mol
SMILES O[C@H]1CC[C@H](C(C)(C)C)CC1
InChIKey CCOQPGVQAWPUPE-KYZUINATSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-4-(2-Methyl-2-propanyl)cyclohexanol (CAS: 21862-63-5)?

trans-4-(2-Methyl-2-propanyl)cyclohexanol is a colorless to light yellow liquid with a molecular wei...

Compound Q&A

How is trans-4-(2-Methyl-2-propanyl)cyclohexanol (CAS: 21862-63-5) typically synthesized?

trans-4-(2-Methyl-2-propanyl)cyclohexanol is typically synthesized through a Wittig reaction or a mo...

Compound Q&A

What industries use trans-4-(2-Methyl-2-propanyl)cyclohexanol (CAS: 21862-63-5)?

trans-4-(2-Methyl-2-propanyl)cyclohexanol is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...