Compound Q&A

What industries use Beta-Acetoxyisovalerylshikonin (CAS: 69091-17-4)?

Answer

Beta-Acetoxyisovalerylshikonin
Beta-Acetoxyisovalerylshikonin (CAS: 69091-17-4) is used in the pharmaceutical industry for its potential anti-inflammatory and antioxidant properties. It also finds applications in the cosmetic industry as a skin care agent. Additionally, it is explored for its use in the food industry as a natural colorant and preservative. Research is ongoing to explore its potential in other fields such as polymer science and materials science.

About

CAS No 69091-17-4
English Name Beta-Acetoxyisovalerylshikonin
Molecular Formula C23H26O8
Molecular Weight 430.45 g/mol
SMILES O=C(CC(OC(=O)C)(C)C)O[C@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)CC=C(C)C
InChIKey BQSAGDWOHVQNFB-SFHVURJKSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Beta-Acetoxyisovalerylshikonin (CAS: 69091-17-4)?

Beta-Acetoxyisovalerylshikonin (CAS: 69091-17-4) is a crystalline compound with a molecular weight o...

Compound Q&A

How is Beta-Acetoxyisovalerylshikonin (CAS: 69091-17-4) typically synthesized?

Beta-Acetoxyisovalerylshikonin (CAS: 69091-17-4) is typically synthesized through a multi-step proce...

Compound Q&A

What precautions should be taken when handling Beta-Acetoxyisovalerylshikonin (CAS: 69091-17-4)?

When handling Beta-Acetoxyisovalerylshikonin (CAS: 69091-17-4), it is important to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...