Compound Q&A

How is 5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II) (CAS: 14172-90-8) typically synthesized?

Answer

5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II)
5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II) is synthesized by the addition of cobalt(II) chloride to 5,10,15,20-tetraphenylporphine in the presence of a mild base such as sodium carbonate. The reaction is typically carried out in an inert solvent like tetrahydrofuran (THF) under reflux conditions. The yield is generally high, and the product is purified by recrystallization from an appropriate solvent.

About

CAS No 14172-90-8
English Name 5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II)
Molecular Formula C44H28CoN4
Molecular Weight 671.65 g/mol
SMILES c1ccc(cc1)/C/1=C/2\C=CC(=N2)/C(=c/2\n3[Co]n4c1ccc4/C(=C\1/C=CC(=N1)/C(=c\3/cc2)/c1ccccc1)/c1ccccc1)/c1ccccc1
InChIKey LSZLYWSRWXFMOI-JJUIXLEHSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II) (CAS: 14172-90-8)?

5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II) is a purple crystalline compound with a high mole...

Compound Q&A

What industries use 5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II) (CAS: 14172-90-8)?

5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II) finds applications in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II) (CAS: 14172-90-8)?

Proper personal protective equipment (PPE) should be worn when handling 5,10,15,20-Tetraphenyl-21H,2...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...