Compound Q&A

How is 4-Nitrobenzenesulfonamide (CAS: 6325-93-5) typically synthesized?

Answer

4-Nitrobenzenesulfonamide
4-Nitrobenzenesulfonamide (CAS: 6325-93-5) is typically synthesized by the reaction of 4-nitrobenzenesulfonic acid with ammonia or an ammonia solution. This process involves heating the mixture to promote the amide formation. The reaction is carried out under basic conditions to ensure the formation of the amide linkage.

About

CAS No 6325-93-5
English Name 4-Nitrobenzenesulfonamide
Molecular Formula C6H6N2O4S
Molecular Weight 202.19 g/mol
SMILES C1=CC(=CC=C1[N+](=O)[O-])S(=O)(=O)N
InChIKey QWKKYJLAUWFPDB-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitrobenzenesulfonamide (CAS: 6325-93-5)?

4-Nitrobenzenesulfonamide (CAS: 6325-93-5) is a white crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 4-Nitrobenzenesulfonamide (CAS: 6325-93-5)?

4-Nitrobenzenesulfonamide (CAS: 6325-93-5) is used in various industries, including the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 4-Nitrobenzenesulfonamide (CAS: 6325-93-5)?

When handling 4-Nitrobenzenesulfonamide (CAS: 6325-93-5), it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...