Compound Q&A

What are the physical and chemical properties of 4-Nitrobenzenesulfonamide (CAS: 6325-93-5)?

Answer

4-Nitrobenzenesulfonamide
4-Nitrobenzenesulfonamide (CAS: 6325-93-5) is a white crystalline solid with a molecular weight of approximately 212.12 g/mol. It is slightly soluble in water and has good solubility in organic solvents like ethanol and acetone. It is relatively stable under normal conditions but can react with strong reducing agents. The compound is used in various chemical reactions and as an intermediate in organic synthesis.

About

CAS No 6325-93-5
English Name 4-Nitrobenzenesulfonamide
Molecular Formula C6H6N2O4S
Molecular Weight 202.19 g/mol
SMILES C1=CC(=CC=C1[N+](=O)[O-])S(=O)(=O)N
InChIKey QWKKYJLAUWFPDB-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is 4-Nitrobenzenesulfonamide (CAS: 6325-93-5) typically synthesized?

4-Nitrobenzenesulfonamide (CAS: 6325-93-5) is typically synthesized by the reaction of 4-nitrobenzen...

Compound Q&A

What industries use 4-Nitrobenzenesulfonamide (CAS: 6325-93-5)?

4-Nitrobenzenesulfonamide (CAS: 6325-93-5) is used in various industries, including the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 4-Nitrobenzenesulfonamide (CAS: 6325-93-5)?

When handling 4-Nitrobenzenesulfonamide (CAS: 6325-93-5), it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...