Compound Q&A

How is 2,4,5,6-Tetrafluoroisophthalic acid (CAS: 1551-39-9) typically synthesized?

Answer

2,4,5,6-Tetrafluoroisophthalic acid
2,4,5,6-Tetrafluoroisophthalic acid is typically synthesized by the fluorination of isophthalic acid. This process often involves the use of Lewis acids as catalysts, such as aluminum chloride or boron trifluoride. The reaction is carried out in an inert solvent like dichloromethane at low temperatures. The yield can be high, and the product is isolated by crystallization from the reaction mixture.

About

CAS No 1551-39-9
English Name 2,4,5,6-Tetrafluoroisophthalic acid
Molecular Formula C8H2F4O4
Molecular Weight 238.09 g/mol
SMILES C1(=C(C(=C(C(=C1F)F)F)C(=O)O)F)C(=O)O
InChIKey PGRIMKUYGUHAKH-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4,5,6-Tetrafluoroisophthalic acid (CAS: 1551-39-9)?

2,4,5,6-Tetrafluoroisophthalic acid is a white crystalline solid with a high melting point. Its mole...

Compound Q&A

What industries use 2,4,5,6-Tetrafluoroisophthalic acid (CAS: 1551-39-9)?

2,4,5,6-Tetrafluoroisophthalic acid is used in various industries. In pharmaceuticals, it serves as ...

Compound Q&A

What precautions should be taken when handling 2,4,5,6-Tetrafluoroisophthalic acid (CAS: 1551-39-9)?

When handling 2,4,5,6-Tetrafluoroisophthalic acid, appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...