Compound Q&A

What are the physical and chemical properties of 2,4,5,6-Tetrafluoroisophthalic acid (CAS: 1551-39-9)?

Answer

2,4,5,6-Tetrafluoroisophthalic acid
2,4,5,6-Tetrafluoroisophthalic acid is a white crystalline solid with a high melting point. Its molecular weight is approximately 262.06 g/mol. It is sparingly soluble in water but soluble in common organic solvents. Chemically, it shows moderate stability with respect to hydrolysis and is reactive towards amines, forming amides. It is also known for its strong acidity, which allows it to react with bases to form salts.

About

CAS No 1551-39-9
English Name 2,4,5,6-Tetrafluoroisophthalic acid
Molecular Formula C8H2F4O4
Molecular Weight 238.09 g/mol
SMILES C1(=C(C(=C(C(=C1F)F)F)C(=O)O)F)C(=O)O
InChIKey PGRIMKUYGUHAKH-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is 2,4,5,6-Tetrafluoroisophthalic acid (CAS: 1551-39-9) typically synthesized?

2,4,5,6-Tetrafluoroisophthalic acid is typically synthesized by the fluorination of isophthalic acid...

Compound Q&A

What industries use 2,4,5,6-Tetrafluoroisophthalic acid (CAS: 1551-39-9)?

2,4,5,6-Tetrafluoroisophthalic acid is used in various industries. In pharmaceuticals, it serves as ...

Compound Q&A

What precautions should be taken when handling 2,4,5,6-Tetrafluoroisophthalic acid (CAS: 1551-39-9)?

When handling 2,4,5,6-Tetrafluoroisophthalic acid, appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...