Compound Q&A

What industries use 4-[(Trifluoromethyl)sulfanyl]benzoic acid (CAS: 330-17-6)?

Answer

4-[(Trifluoromethyl)sulfanyl]benzoic acid
4-[(Trifluoromethyl)sulfanyl]benzoic acid is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly in the development of anti-inflammatory and antiviral drugs. It also finds applications in the production of sensors and as a building block in the synthesis of polymers and semiconductors.

About

CAS No 330-17-6
English Name 4-[(Trifluoromethyl)sulfanyl]benzoic acid
Molecular Formula C8H5F3O2S
Molecular Weight 222.19 g/mol
SMILES C1=CC(=CC=C1C(=O)O)SC(F)(F)F
InChIKey UMOGQQWVQUQTQA-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(Trifluoromethyl)sulfanyl]benzoic acid (CAS: 330-17-6)?

4-[(Trifluoromethyl)sulfanyl]benzoic acid is a white solid with a molecular weight of approximately ...

Compound Q&A

How is 4-[(Trifluoromethyl)sulfanyl]benzoic acid (CAS: 330-17-6) typically synthesized?

4-[(Trifluoromethyl)sulfanyl]benzoic acid is typically synthesized via the sulfonation of 4-bromoben...

Compound Q&A

What precautions should be taken when handling 4-[(Trifluoromethyl)sulfanyl]benzoic acid (CAS: 330-17-6)?

When handling 4-[(Trifluoromethyl)sulfanyl]benzoic acid, proper personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...